C17H18F6N4O5 — CID 154511731
(2R)-2-[[4-[bis(2,2,2-trifluoroethyl)carbamoyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylic acid (PubChem CID 154511731) has the molecular formula C17H18F6N4O5 and a molecular weight of 472.34 g/mol. Its IUPAC name is (2R)-2-[[4-[bis(2,2,2-trifluoroethyl)carbamoyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-2-[[4-[bis(2,2,2-trifluoroethyl)carbamoyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154511731 |
| Molecular Formula | C17H18F6N4O5 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (2R)-2-[[4-[bis(2,2,2-trifluoroethyl)carbamoyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(c1ccc(NC[C@H]2CCCN2C(=O)O)c([N+](=O)[O-])c1)N(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C17H18F6N4O5/c18-16(19,20)8-25(9-17(21,22)23)14(28)10-3-4-12(13(6-10)27(31)32)24-7-11-2-1-5-26(11)15(29)30/h3-4,6,11,24H,1-2,5,7-9H2,(H,29,30)/t11-/m1/s1 |
| InChIKey | RFOMZBQIAYGNOO-LLVKDONJSA-N |
| XLogP | 3.72 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|