C20H26N6O — CID 69053002
hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine (PubChem CID 69053002) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine.
| Compound Name | hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 69053002 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine |
| SMILES | Cc1cc2c(-c3ccc(OC4CCNCC4)c(C)c3)ncnc2cn1.NN |
| InChI | InChI=1S/C20H22N4O.H4N2/c1-13-9-15(3-4-19(13)25-16-5-7-21-8-6-16)20-17-10-14(2)22-11-18(17)23-12-24-20;1-2/h3-4,9-12,16,21H,5-8H2,1-2H3;1-2H2 |
| InChIKey | NCKJYAKRIPGGHU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|