About hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine
hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine (PubChem CID 69053002) has the molecular formula C20H26N6O
and a molecular weight of 366.47 g/mol. Its IUPAC name is hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine |
| PubChem CID | 69053002 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine |
| SMILES | Cc1cc2c(-c3ccc(OC4CCNCC4)c(C)c3)ncnc2cn1.NN |
| InChI | InChI=1S/C20H22N4O.H4N2/c1-13-9-15(3-4-19(13)25-16-5-7-21-8-6-16)20-17-10-14(2)22-11-18(17)23-12-24-20;1-2/h3-4,9-12,16,21H,5-8H2,1-2H3;1-2H2 |
| InChIKey | NCKJYAKRIPGGHU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine?
The IUPAC name of hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine (CID 69053002) is hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine.
What is the SMILES notation for hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine?
The canonical SMILES for hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine is Cc1cc2c(-c3ccc(OC4CCNCC4)c(C)c3)ncnc2cn1.NN.
What is the InChIKey of hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine?
The InChIKey is NCKJYAKRIPGGHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O.H4N2/c1-13-9-15(3-4-19(13)25-16-5-7-21-8-6-16)20-17-10-14(2)22-11-18(17)23-12-24-20;1-2/h3-4,9-12,16,21H,5-8H2,1-2H3;1-2H2.
What are the key properties of hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine?
hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine has a molecular weight of 366.47 g/mol, XLogP of 2.26, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;6-methyl-4-(3-methyl-4-piperidin-4-yloxyphenyl)pyrido[3,4-d]pyrimidine is sourced from PubChem (CID 69053002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).