About acetic acid;1H-pyridazin-6-one;pyridine
acetic acid;1H-pyridazin-6-one;pyridine (PubChem CID 69053307) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is acetic acid;1H-pyridazin-6-one;pyridine.
Molecular Properties
| Compound Name | acetic acid;1H-pyridazin-6-one;pyridine |
| PubChem CID | 69053307 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | acetic acid;1H-pyridazin-6-one;pyridine |
| SMILES | CC(=O)O.O=c1cccn[nH]1.c1ccncc1 |
| InChI | InChI=1S/C5H5N.C4H4N2O.C2H4O2/c1-2-4-6-5-3-1;7-4-2-1-3-5-6-4;1-2(3)4/h1-5H;1-3H,(H,6,7);1H3,(H,3,4) |
| InChIKey | GVGZZOKTKNYZKT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;1H-pyridazin-6-one;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1H-pyridazin-6-one;pyridine?
The IUPAC name of acetic acid;1H-pyridazin-6-one;pyridine (CID 69053307) is acetic acid;1H-pyridazin-6-one;pyridine.
What is the SMILES notation for acetic acid;1H-pyridazin-6-one;pyridine?
The canonical SMILES for acetic acid;1H-pyridazin-6-one;pyridine is CC(=O)O.O=c1cccn[nH]1.c1ccncc1.
What is the InChIKey of acetic acid;1H-pyridazin-6-one;pyridine?
The InChIKey is GVGZZOKTKNYZKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C4H4N2O.C2H4O2/c1-2-4-6-5-3-1;7-4-2-1-3-5-6-4;1-2(3)4/h1-5H;1-3H,(H,6,7);1H3,(H,3,4).
What are the key properties of acetic acid;1H-pyridazin-6-one;pyridine?
acetic acid;1H-pyridazin-6-one;pyridine has a molecular weight of 235.24 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1H-pyridazin-6-one;pyridine is sourced from PubChem (CID 69053307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).