C23H25F3N2O4 — CID 69057609
(3S)-N-benzyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine;but-2-enedioic acid (PubChem CID 69057609) has the molecular formula C23H25F3N2O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is (3S)-N-benzyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine;but-2-enedioic acid.
| Compound Name | (3S)-N-benzyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine;but-2-enedioic acid |
|---|---|
| PubChem CID | 69057609 |
| Molecular Formula | C23H25F3N2O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (3S)-N-benzyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine;but-2-enedioic acid |
| SMILES | FC(F)(F)c1ccccc1CN(Cc1ccccc1)[C@H]1CCNC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H21F3N2.C4H4O4/c20-19(21,22)18-9-5-4-8-16(18)14-24(17-10-11-23-12-17)13-15-6-2-1-3-7-15;5-3(6)1-2-4(7)8/h1-9,17,23H,10-14H2;1-2H,(H,5,6)(H,7,8)/t17-;/m0./s1 |
| InChIKey | CDVPHHFFPCDTLJ-LMOVPXPDSA-N |
| XLogP | 3.78 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|