C25H32N2O5 — CID 69059391
but-2-enedioic acid;(3S)-N-(2-methylpropyl)-N-[(2-phenoxyphenyl)methyl]pyrrolidin-3-amine (PubChem CID 69059391) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is but-2-enedioic acid;(3S)-N-(2-methylpropyl)-N-[(2-phenoxyphenyl)methyl]pyrrolidin-3-amine.
| Compound Name | but-2-enedioic acid;(3S)-N-(2-methylpropyl)-N-[(2-phenoxyphenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 69059391 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | but-2-enedioic acid;(3S)-N-(2-methylpropyl)-N-[(2-phenoxyphenyl)methyl]pyrrolidin-3-amine |
| SMILES | CC(C)CN(Cc1ccccc1Oc1ccccc1)[C@H]1CCNC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C21H28N2O.C4H4O4/c1-17(2)15-23(19-12-13-22-14-19)16-18-8-6-7-11-21(18)24-20-9-4-3-5-10-20;5-3(6)1-2-4(7)8/h3-11,17,19,22H,12-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/t19-;/m0./s1 |
| InChIKey | FQBNVHFQZACHHT-FYZYNONXSA-N |
| XLogP | 4.01 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|