C21H32N2O5 — CID 69062038
but-2-enedioic acid;(3S)-N-[(2-ethoxyphenyl)methyl]-N-(2-methylpropyl)pyrrolidin-3-amine (PubChem CID 69062038) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is but-2-enedioic acid;(3S)-N-[(2-ethoxyphenyl)methyl]-N-(2-methylpropyl)pyrrolidin-3-amine.
| Compound Name | but-2-enedioic acid;(3S)-N-[(2-ethoxyphenyl)methyl]-N-(2-methylpropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 69062038 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | but-2-enedioic acid;(3S)-N-[(2-ethoxyphenyl)methyl]-N-(2-methylpropyl)pyrrolidin-3-amine |
| SMILES | CCOc1ccccc1CN(CC(C)C)[C@H]1CCNC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H28N2O.C4H4O4/c1-4-20-17-8-6-5-7-15(17)13-19(12-14(2)3)16-9-10-18-11-16;5-3(6)1-2-4(7)8/h5-8,14,16,18H,4,9-13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/t16-;/m0./s1 |
| InChIKey | KSVOACSRPDPHOX-NTISSMGPSA-N |
| XLogP | 2.62 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|