C15H22N2O3S2 — CID 69059184
N'-[5-(1-cyclopentyl-3-hydroxyprop-1-en-2-yl)thiophen-2-yl]sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 69059184) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is N'-[5-(1-cyclopentyl-3-hydroxyprop-1-en-2-yl)thiophen-2-yl]sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-(1-cyclopentyl-3-hydroxyprop-1-en-2-yl)thiophen-2-yl]sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 69059184 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N'-[5-(1-cyclopentyl-3-hydroxyprop-1-en-2-yl)thiophen-2-yl]sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=NS(=O)(=O)c1ccc(C(=CC2CCCC2)CO)s1 |
| InChI | InChI=1S/C15H22N2O3S2/c1-17(2)11-16-22(19,20)15-8-7-14(21-15)13(10-18)9-12-5-3-4-6-12/h7-9,11-12,18H,3-6,10H2,1-2H3 |
| InChIKey | SDRRIANLGFLZBJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|