C27H34O4 — CID 69063043
3,3-diphenylpropyl 4-(2-cyclohexylethoxy)-3-oxobutanoate (PubChem CID 69063043) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3,3-diphenylpropyl 4-(2-cyclohexylethoxy)-3-oxobutanoate.
| Compound Name | 3,3-diphenylpropyl 4-(2-cyclohexylethoxy)-3-oxobutanoate |
|---|---|
| PubChem CID | 69063043 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 3,3-diphenylpropyl 4-(2-cyclohexylethoxy)-3-oxobutanoate |
| SMILES | O=C(COCCC1CCCCC1)CC(=O)OCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34O4/c28-25(21-30-18-16-22-10-4-1-5-11-22)20-27(29)31-19-17-26(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h2-3,6-9,12-15,22,26H,1,4-5,10-11,16-21H2 |
| InChIKey | CFABAZQWJNQIGV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|