C18H20N4O2 — CID 69070012
1-[6-(4-methoxyphenyl)-1H-indazol-3-yl]-3-propan-2-ylurea (PubChem CID 69070012) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[6-(4-methoxyphenyl)-1H-indazol-3-yl]-3-propan-2-ylurea.
| Compound Name | 1-[6-(4-methoxyphenyl)-1H-indazol-3-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 69070012 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[6-(4-methoxyphenyl)-1H-indazol-3-yl]-3-propan-2-ylurea |
| SMILES | COc1ccc(-c2ccc3c(NC(=O)NC(C)C)n[nH]c3c2)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-11(2)19-18(23)20-17-15-9-6-13(10-16(15)21-22-17)12-4-7-14(24-3)8-5-12/h4-11H,1-3H3,(H3,19,20,21,22,23) |
| InChIKey | ZVTXMSNTFADFSQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |