C21H20N2O6S — CID 69076317
3-[(E)-3-(4-hydroxy-1,1-dioxo-2H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]-N-(2-methoxyethyl)benzamide (PubChem CID 69076317) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is 3-[(E)-3-(4-hydroxy-1,1-dioxo-2H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[(E)-3-(4-hydroxy-1,1-dioxo-2H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 69076317 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-[(E)-3-(4-hydroxy-1,1-dioxo-2H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(/C=C/C(=O)C2=C(O)c3ccccc3S(=O)(=O)N2)c1 |
| InChI | InChI=1S/C21H20N2O6S/c1-29-12-11-22-21(26)15-6-4-5-14(13-15)9-10-17(24)19-20(25)16-7-2-3-8-18(16)30(27,28)23-19/h2-10,13,23,25H,11-12H2,1H3,(H,22,26)/b10-9+ |
| InChIKey | VXBISHJKTPMJRQ-MDZDMXLPSA-N |
| XLogP | 1.86 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|