C17H25Cl3N4O2 — CID 69076885
4-(1-aminoethyl)-3-(3-aminopropoxy)-N-pyridin-4-ylbenzamide;trihydrochloride (PubChem CID 69076885) has the molecular formula C17H25Cl3N4O2 and a molecular weight of 423.77 g/mol. Its IUPAC name is 4-(1-aminoethyl)-3-(3-aminopropoxy)-N-pyridin-4-ylbenzamide;trihydrochloride.
| Compound Name | 4-(1-aminoethyl)-3-(3-aminopropoxy)-N-pyridin-4-ylbenzamide;trihydrochloride |
|---|---|
| PubChem CID | 69076885 |
| Molecular Formula | C17H25Cl3N4O2 |
| Molecular Weight | 423.77 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 4-(1-aminoethyl)-3-(3-aminopropoxy)-N-pyridin-4-ylbenzamide;trihydrochloride |
| SMILES | CC(N)c1ccc(C(=O)Nc2ccncc2)cc1OCCCN.Cl.Cl.Cl |
| InChI | InChI=1S/C17H22N4O2.3ClH/c1-12(19)15-4-3-13(11-16(15)23-10-2-7-18)17(22)21-14-5-8-20-9-6-14;;;/h3-6,8-9,11-12H,2,7,10,18-19H2,1H3,(H,20,21,22);3*1H |
| InChIKey | BEOYIMNNBHIEOW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|