C14H16Cl2N4O3 — CID 69077276
4-(1-aminoethyl)-3-nitro-N-pyridin-4-ylbenzamide;dihydrochloride (PubChem CID 69077276) has the molecular formula C14H16Cl2N4O3 and a molecular weight of 359.21 g/mol. Its IUPAC name is 4-(1-aminoethyl)-3-nitro-N-pyridin-4-ylbenzamide;dihydrochloride.
| Compound Name | 4-(1-aminoethyl)-3-nitro-N-pyridin-4-ylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 69077276 |
| Molecular Formula | C14H16Cl2N4O3 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-(1-aminoethyl)-3-nitro-N-pyridin-4-ylbenzamide;dihydrochloride |
| SMILES | CC(N)c1ccc(C(=O)Nc2ccncc2)cc1[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C14H14N4O3.2ClH/c1-9(15)12-3-2-10(8-13(12)18(20)21)14(19)17-11-4-6-16-7-5-11;;/h2-9H,15H2,1H3,(H,16,17,19);2*1H |
| InChIKey | YYSGRKVIPQLMSY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|