C21H21N5OS — CID 16665978
4-(1-aminoethyl)-3-(phenylcarbamothioylamino)-N-pyridin-4-ylbenzamide (PubChem CID 16665978) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-(1-aminoethyl)-3-(phenylcarbamothioylamino)-N-pyridin-4-ylbenzamide.
| Compound Name | 4-(1-aminoethyl)-3-(phenylcarbamothioylamino)-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 16665978 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-(1-aminoethyl)-3-(phenylcarbamothioylamino)-N-pyridin-4-ylbenzamide |
| SMILES | CC(N)c1ccc(C(=O)Nc2ccncc2)cc1NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C21H21N5OS/c1-14(22)18-8-7-15(20(27)24-17-9-11-23-12-10-17)13-19(18)26-21(28)25-16-5-3-2-4-6-16/h2-14H,22H2,1H3,(H,23,24,27)(H2,25,26,28) |
| InChIKey | VMYURESBBLJWJJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|