C40H56F3N5O4S — CID 69077148
2-[1-[(Z)-1-(aminomethylideneamino)heptadec-8-en-3-yl]sulfonylpiperidin-4-yl]-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-3-phenylpropanamide (PubChem CID 69077148) has the molecular formula C40H56F3N5O4S and a molecular weight of 759.98 g/mol. Its IUPAC name is 2-[1-[(Z)-1-(aminomethylideneamino)heptadec-8-en-3-yl]sulfonylpiperidin-4-yl]-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-3-phenylpropanamide.
| Compound Name | 2-[1-[(Z)-1-(aminomethylideneamino)heptadec-8-en-3-yl]sulfonylpiperidin-4-yl]-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 69077148 |
| Molecular Formula | C40H56F3N5O4S |
| Molecular Weight | 759.98 g/mol |
| Exact Mass | 759.40 |
| IUPAC Name | 2-[1-[(Z)-1-(aminomethylideneamino)heptadec-8-en-3-yl]sulfonylpiperidin-4-yl]-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-3-phenylpropanamide |
| SMILES | CCCCCCCC/C=C\CCCCC(CC/N=C/N)S(=O)(=O)N1CCC(C(O)(Cc2ccccc2)C(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C40H56F3N5O4S/c1-2-3-4-5-6-7-8-9-10-11-12-16-19-36(22-25-46-31-45)53(51,52)48-26-23-34(24-27-48)39(50,29-32-17-14-13-15-18-32)38(49)47-35-21-20-33(30-44)37(28-35)40(41,42)43/h9-10,13-15,17-18,20-21,28,31,34,36,50H,2-8,11-12,16,19,22-27,29H2,1H3,(H2,45,46)(H,47,49)/b10-9- |
| InChIKey | SKXNCXCRLQQRMU-KTKRTIGZSA-N |
| XLogP | 8.14 |
| TPSA | 148.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.98 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|