C27H35N3O5S — CID 69077465
2-[(2R)-5,5-dimethyl-3-oxo-1-(2,4,6-trimethylphenyl)sulfonylpiperazin-2-yl]-N-[(1R)-5-(hydroxymethyl)-2,3-dihydro-1H-inden-1-yl]acetamide (PubChem CID 69077465) has the molecular formula C27H35N3O5S and a molecular weight of 513.66 g/mol. Its IUPAC name is 2-[(2R)-5,5-dimethyl-3-oxo-1-(2,4,6-trimethylphenyl)sulfonylpiperazin-2-yl]-N-[(1R)-5-(hydroxymethyl)-2,3-dihydro-1H-inden-1-yl]acetamide.
| Compound Name | 2-[(2R)-5,5-dimethyl-3-oxo-1-(2,4,6-trimethylphenyl)sulfonylpiperazin-2-yl]-N-[(1R)-5-(hydroxymethyl)-2,3-dihydro-1H-inden-1-yl]acetamide |
|---|---|
| PubChem CID | 69077465 |
| Molecular Formula | C27H35N3O5S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 2-[(2R)-5,5-dimethyl-3-oxo-1-(2,4,6-trimethylphenyl)sulfonylpiperazin-2-yl]-N-[(1R)-5-(hydroxymethyl)-2,3-dihydro-1H-inden-1-yl]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CC(C)(C)NC(=O)[C@H]2CC(=O)N[C@@H]2CCc3cc(CO)ccc32)c(C)c1 |
| InChI | InChI=1S/C27H35N3O5S/c1-16-10-17(2)25(18(3)11-16)36(34,35)30-15-27(4,5)29-26(33)23(30)13-24(32)28-22-9-7-20-12-19(14-31)6-8-21(20)22/h6,8,10-12,22-23,31H,7,9,13-15H2,1-5H3,(H,28,32)(H,29,33)/t22-,23-/m1/s1 |
| InChIKey | IMVBAVMIDZKZDU-DHIUTWEWSA-N |
| XLogP | 2.57 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |