C36H45N3O3S — CID 11227202
N-[6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(2R)-1-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]acetamide (PubChem CID 11227202) has the molecular formula C36H45N3O3S and a molecular weight of 599.84 g/mol. Its IUPAC name is N-[6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(2R)-1-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]acetamide.
| Compound Name | N-[6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(2R)-1-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 11227202 |
| Molecular Formula | C36H45N3O3S |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | N-[6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(2R)-1-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2c3ccccc3CC[C@@H]2CC(=O)NC2CCCc3cc(CN4CCCCC4)ccc32)c(C)c1 |
| InChI | InChI=1S/C36H45N3O3S/c1-25-20-26(2)36(27(3)21-25)43(41,42)39-31(16-15-29-10-5-6-13-34(29)39)23-35(40)37-33-12-9-11-30-22-28(14-17-32(30)33)24-38-18-7-4-8-19-38/h5-6,10,13-14,17,20-22,31,33H,4,7-9,11-12,15-16,18-19,23-24H2,1-3H3,(H,37,40)/t31-,33?/m1/s1 |
| InChIKey | FFHPNWONDPWARZ-GWLFDFPQSA-N |
| XLogP | 6.69 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |