C32H40N2O4S — CID 11570254
(2R)-2-hydroxy-3,3-dimethyl-4-naphthalen-2-ylsulfonyl-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide (PubChem CID 11570254) has the molecular formula C32H40N2O4S and a molecular weight of 548.75 g/mol. Its IUPAC name is (2R)-2-hydroxy-3,3-dimethyl-4-naphthalen-2-ylsulfonyl-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide.
| Compound Name | (2R)-2-hydroxy-3,3-dimethyl-4-naphthalen-2-ylsulfonyl-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
|---|---|
| PubChem CID | 11570254 |
| Molecular Formula | C32H40N2O4S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | (2R)-2-hydroxy-3,3-dimethyl-4-naphthalen-2-ylsulfonyl-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butanamide |
| SMILES | CC(C)(CS(=O)(=O)c1ccc2ccccc2c1)[C@@H](O)C(=O)N[C@@H]1CCCc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C32H40N2O4S/c1-32(2,22-39(37,38)27-15-14-24-9-4-5-10-25(24)20-27)30(35)31(36)33-29-12-8-11-26-19-23(13-16-28(26)29)21-34-17-6-3-7-18-34/h4-5,9-10,13-16,19-20,29-30,35H,3,6-8,11-12,17-18,21-22H2,1-2H3,(H,33,36)/t29-,30+/m1/s1 |
| InChIKey | FNILSGVIJILRFQ-IHLOFXLRSA-N |
| XLogP | 5.18 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |