C20H30N4O3Si — CID 69079558
2-[4-[tert-butyl(dimethyl)silyl]oxypyrazol-1-yl]-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide (PubChem CID 69079558) has the molecular formula C20H30N4O3Si and a molecular weight of 402.57 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxypyrazol-1-yl]-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxypyrazol-1-yl]-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide |
|---|---|
| PubChem CID | 69079558 |
| Molecular Formula | C20H30N4O3Si |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxypyrazol-1-yl]-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide |
| SMILES | CN1CCOc2cc(NC(=O)Cn3cc(O[Si](C)(C)C(C)(C)C)cn3)ccc21 |
| InChI | InChI=1S/C20H30N4O3Si/c1-20(2,3)28(5,6)27-16-12-21-24(13-16)14-19(25)22-15-7-8-17-18(11-15)26-10-9-23(17)4/h7-8,11-13H,9-10,14H2,1-6H3,(H,22,25) |
| InChIKey | CSDLYAVDHKSQDA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|