C24H26FN3O3 — CID 69080506
1-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxopropyl]-3-phenylpiperidine-2,6-dione (PubChem CID 69080506) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxopropyl]-3-phenylpiperidine-2,6-dione.
| Compound Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxopropyl]-3-phenylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 69080506 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxopropyl]-3-phenylpiperidine-2,6-dione |
| SMILES | O=C(CN1CCN(c2ccc(F)cc2)CC1)CN1C(=O)CCC(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H26FN3O3/c25-19-6-8-20(9-7-19)27-14-12-26(13-15-27)16-21(29)17-28-23(30)11-10-22(24(28)31)18-4-2-1-3-5-18/h1-9,22H,10-17H2 |
| InChIKey | BLORPGNAMKKRKH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|