C43H47NO9 — CID 69083063
(2S,3S)-4-[1-[(1R)-2-(dimethylamino)-1-(4-phenylmethoxyphenyl)ethyl]cyclohexyl]oxy-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 69083063) has the molecular formula C43H47NO9 and a molecular weight of 721.85 g/mol. Its IUPAC name is (2S,3S)-4-[1-[(1R)-2-(dimethylamino)-1-(4-phenylmethoxyphenyl)ethyl]cyclohexyl]oxy-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2S,3S)-4-[1-[(1R)-2-(dimethylamino)-1-(4-phenylmethoxyphenyl)ethyl]cyclohexyl]oxy-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 69083063 |
| Molecular Formula | C43H47NO9 |
| Molecular Weight | 721.85 g/mol |
| Exact Mass | 721.33 |
| IUPAC Name | (2S,3S)-4-[1-[(1R)-2-(dimethylamino)-1-(4-phenylmethoxyphenyl)ethyl]cyclohexyl]oxy-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | Cc1ccc(C(=O)O[C@H](C(=O)O)[C@H](OC(=O)c2ccc(C)cc2)C(=O)OC2([C@@H](CN(C)C)c3ccc(OCc4ccccc4)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C43H47NO9/c1-29-13-17-33(18-14-29)40(47)51-37(39(45)46)38(52-41(48)34-19-15-30(2)16-20-34)42(49)53-43(25-9-6-10-26-43)36(27-44(3)4)32-21-23-35(24-22-32)50-28-31-11-7-5-8-12-31/h5,7-8,11-24,36-38H,6,9-10,25-28H2,1-4H3,(H,45,46)/t36-,37-,38-/m0/s1 |
| InChIKey | OPQWGELAXOLUDC-QXUSSCGESA-N |
| XLogP | 7.31 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.85 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|