C32H37NO5 — CID 15983531
[4-[2-(dimethylamino)-1-[1-(4-methoxybenzoyl)oxycyclohexyl]ethyl]phenyl] 4-methylbenzoate (PubChem CID 15983531) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is [4-[2-(dimethylamino)-1-[1-(4-methoxybenzoyl)oxycyclohexyl]ethyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[2-(dimethylamino)-1-[1-(4-methoxybenzoyl)oxycyclohexyl]ethyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 15983531 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | [4-[2-(dimethylamino)-1-[1-(4-methoxybenzoyl)oxycyclohexyl]ethyl]phenyl] 4-methylbenzoate |
| SMILES | COc1ccc(C(=O)OC2(C(CN(C)C)c3ccc(OC(=O)c4ccc(C)cc4)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C32H37NO5/c1-23-8-10-25(11-9-23)30(34)37-28-18-12-24(13-19-28)29(22-33(2)3)32(20-6-5-7-21-32)38-31(35)26-14-16-27(36-4)17-15-26/h8-19,29H,5-7,20-22H2,1-4H3 |
| InChIKey | DSWJSUSDBWYEEX-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|