C21H29NO5 — CID 69404467
(Z)-4-[1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexyl]oxy-4-oxobut-2-enoic acid (PubChem CID 69404467) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is (Z)-4-[1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexyl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexyl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 69404467 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (Z)-4-[1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexyl]oxy-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(C(CN(C)C)C2(OC(=O)/C=C\C(=O)O)CCCCC2)cc1 |
| InChI | InChI=1S/C21H29NO5/c1-22(2)15-18(16-7-9-17(26-3)10-8-16)21(13-5-4-6-14-21)27-20(25)12-11-19(23)24/h7-12,18H,4-6,13-15H2,1-3H3,(H,23,24)/b12-11- |
| InChIKey | WGVBJPWBBMRUKS-QXMHVHEDSA-N |
| XLogP | 3.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|