C21H27NO4 — CID 46221265
[4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] furan-2-carboxylate (PubChem CID 46221265) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is [4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 46221265 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] furan-2-carboxylate |
| SMILES | CN(C)CC(c1ccc(OC(=O)c2ccco2)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C21H27NO4/c1-22(2)15-18(21(24)12-4-3-5-13-21)16-8-10-17(11-9-16)26-20(23)19-7-6-14-25-19/h6-11,14,18,24H,3-5,12-13,15H2,1-2H3 |
| InChIKey | ITHAZNNGJHRYPU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|