C24H29O5Sn — CID 174713634
CID 174713634 (PubChem CID 174713634) has the molecular formula C24H29O5Sn and a molecular weight of 516.20 g/mol.
| Compound Name | CID 174713634 |
|---|---|
| PubChem CID | 174713634 |
| Molecular Formula | C24H29O5Sn |
| Molecular Weight | 516.20 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | — |
| SMILES | C[Sn](C)CC(c1ccc(OC(=O)c2ccc3c(c2)OCO3)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C22H23O5.2CH3.Sn/c1-15(22(24)11-3-2-4-12-22)16-5-8-18(9-6-16)27-21(23)17-7-10-19-20(13-17)26-14-25-19;;;/h5-10,13,15,24H,1-4,11-12,14H2;2*1H3; |
| InChIKey | ILJVYZIKMUVPTM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.20 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|