C23H28FNO3 — CID 142694539
[4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] 2-fluorobenzoate (PubChem CID 142694539) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is [4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 142694539 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | [4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] 2-fluorobenzoate |
| SMILES | CN(C)CC(c1ccc(OC(=O)c2ccccc2F)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C23H28FNO3/c1-25(2)16-20(23(27)14-6-3-7-15-23)17-10-12-18(13-11-17)28-22(26)19-8-4-5-9-21(19)24/h4-5,8-13,20,27H,3,6-7,14-16H2,1-2H3 |
| InChIKey | SVAFOQRPZJHZJS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|