C21H33NO3 — CID 69422151
[4-[(1S)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 69422151) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is [4-[(1S)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(1S)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 69422151 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | [4-[(1S)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CN(C)C[C@H](c1ccc(OC(=O)C(C)(C)C)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C21H33NO3/c1-20(2,3)19(23)25-17-11-9-16(10-12-17)18(15-22(4)5)21(24)13-7-6-8-14-21/h9-12,18,24H,6-8,13-15H2,1-5H3/t18-/m1/s1 |
| InChIKey | FUXATIPTCIXOBF-GOSISDBHSA-N |
| XLogP | 3.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|