C16H25NO2 — CID 25226830
2,6-dideuterio-4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol (PubChem CID 25226830) has the molecular formula C16H25NO2 and a molecular weight of 265.39 g/mol. Its IUPAC name is 2,6-dideuterio-4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol.
| Compound Name | 2,6-dideuterio-4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol |
|---|---|
| PubChem CID | 25226830 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2,6-dideuterio-4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol |
| SMILES | [2H]c1cc(C(CN(C)C)C2(O)CCCCC2)cc([2H])c1O |
| InChI | InChI=1S/C16H25NO2/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16/h6-9,15,18-19H,3-5,10-12H2,1-2H3/i8D,9D |
| InChIKey | KYYIDSXMWOZKMP-XETGXLELSA-N |
| XLogP | 2.73 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |