C18H31NO5S — CID 44517185
4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;ethanesulfonic acid (PubChem CID 44517185) has the molecular formula C18H31NO5S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;ethanesulfonic acid.
| Compound Name | 4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;ethanesulfonic acid |
|---|---|
| PubChem CID | 44517185 |
| Molecular Formula | C18H31NO5S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;ethanesulfonic acid |
| SMILES | CCS(=O)(=O)O.CN(C)CC(c1ccc(O)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H25NO2.C2H6O3S/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16;1-2-6(3,4)5/h6-9,15,18-19H,3-5,10-12H2,1-2H3;2H2,1H3,(H,3,4,5) |
| InChIKey | QZFNNPSUVNSFHE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|