C18H28O2 — CID 143726784
4-[1-(1-hydroxycyclohexyl)-4-methylpentyl]phenol (PubChem CID 143726784) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 4-[1-(1-hydroxycyclohexyl)-4-methylpentyl]phenol.
| Compound Name | 4-[1-(1-hydroxycyclohexyl)-4-methylpentyl]phenol |
|---|---|
| PubChem CID | 143726784 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 4-[1-(1-hydroxycyclohexyl)-4-methylpentyl]phenol |
| SMILES | CC(C)CCC(c1ccc(O)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C18H28O2/c1-14(2)6-11-17(15-7-9-16(19)10-8-15)18(20)12-4-3-5-13-18/h7-10,14,17,19-20H,3-6,11-13H2,1-2H3 |
| InChIKey | FYRYMATXXZUYSY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |