C16H24O2 — CID 129084956
1-(4-hydroxy-1-phenylbutyl)cyclohexan-1-ol (PubChem CID 129084956) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(4-hydroxy-1-phenylbutyl)cyclohexan-1-ol.
| Compound Name | 1-(4-hydroxy-1-phenylbutyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 129084956 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-(4-hydroxy-1-phenylbutyl)cyclohexan-1-ol |
| SMILES | OCCCC(c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H24O2/c17-13-7-10-15(14-8-3-1-4-9-14)16(18)11-5-2-6-12-16/h1,3-4,8-9,15,17-18H,2,5-7,10-13H2 |
| InChIKey | DTNBSDVHSBUWPB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |