C27H29N3O3S — CID 69084675
2-cyclopropyl-9-(4-quinolin-7-ylphenyl)sulfonyl-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 69084675) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 2-cyclopropyl-9-(4-quinolin-7-ylphenyl)sulfonyl-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-cyclopropyl-9-(4-quinolin-7-ylphenyl)sulfonyl-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 69084675 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-cyclopropyl-9-(4-quinolin-7-ylphenyl)sulfonyl-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1CCC2(CCN(S(=O)(=O)c3ccc(-c4ccc5cccnc5c4)cc3)CC2)CN1C1CC1 |
| InChI | InChI=1S/C27H29N3O3S/c31-26-11-12-27(19-30(26)23-7-8-23)13-16-29(17-14-27)34(32,33)24-9-5-20(6-10-24)22-4-3-21-2-1-15-28-25(21)18-22/h1-6,9-10,15,18,23H,7-8,11-14,16-17,19H2 |
| InChIKey | UQGIVLGWIVLABY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |