C18H18N2O4S — CID 69086548
3-(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-2-hydroxyprop-2-enamide (PubChem CID 69086548) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-2-hydroxyprop-2-enamide.
| Compound Name | 3-(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-2-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 69086548 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)-2-hydroxyprop-2-enamide |
| SMILES | NC(=O)C(O)=Cc1ccc2c(c1)CN(S(=O)(=O)Cc1ccccc1)C2 |
| InChI | InChI=1S/C18H18N2O4S/c19-18(22)17(21)9-14-6-7-15-10-20(11-16(15)8-14)25(23,24)12-13-4-2-1-3-5-13/h1-9,21H,10-12H2,(H2,19,22) |
| InChIKey | MFFXGPXLDCKHLO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|