C21H25N3O3S — CID 162676853
1-[4-(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)piperazin-1-yl]ethanone (PubChem CID 162676853) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-[4-(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 162676853 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-[4-(2-benzylsulfonyl-1,3-dihydroisoindol-5-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc3c(c2)CN(S(=O)(=O)Cc2ccccc2)C3)CC1 |
| InChI | InChI=1S/C21H25N3O3S/c1-17(25)22-9-11-23(12-10-22)21-8-7-19-14-24(15-20(19)13-21)28(26,27)16-18-5-3-2-4-6-18/h2-8,13H,9-12,14-16H2,1H3 |
| InChIKey | MBHNZXFPJRSSRS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|