C24H25FN4O4S — CID 69086929
(4S)-2-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-3H-pyrido[1,2-a]pyrazine-4-carboxamide (PubChem CID 69086929) has the molecular formula C24H25FN4O4S and a molecular weight of 484.55 g/mol. Its IUPAC name is (4S)-2-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-3H-pyrido[1,2-a]pyrazine-4-carboxamide.
| Compound Name | (4S)-2-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-3H-pyrido[1,2-a]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 69086929 |
| Molecular Formula | C24H25FN4O4S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (4S)-2-ethyl-7-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-3H-pyrido[1,2-a]pyrazine-4-carboxamide |
| SMILES | CCN1C[C@@](C)(C(=O)N(C)C)n2cc(-c3ncc(Cc4ccc(F)cc4)s3)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C24H25FN4O4S/c1-5-28-13-24(2,23(33)27(3)4)29-12-17(19(30)20(31)18(29)22(28)32)21-26-11-16(34-21)10-14-6-8-15(25)9-7-14/h6-9,11-12,31H,5,10,13H2,1-4H3/t24-/m0/s1 |
| InChIKey | ZWTWCHUNSNQFIW-DEOSSOPVSA-N |
| XLogP | 2.69 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |