C27H29FN4O4S — CID 69086953
(4R)-2-[(1S)-1-cyclopropylethyl]-7-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-3H-pyrido[1,2-a]pyrazine-4-carboxamide (PubChem CID 69086953) has the molecular formula C27H29FN4O4S and a molecular weight of 524.62 g/mol. Its IUPAC name is (4R)-2-[(1S)-1-cyclopropylethyl]-7-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-3H-pyrido[1,2-a]pyrazine-4-carboxamide.
| Compound Name | (4R)-2-[(1S)-1-cyclopropylethyl]-7-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-3H-pyrido[1,2-a]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 69086953 |
| Molecular Formula | C27H29FN4O4S |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (4R)-2-[(1S)-1-cyclopropylethyl]-7-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-3H-pyrido[1,2-a]pyrazine-4-carboxamide |
| SMILES | C[C@@H](C1CC1)N1C[C@](C)(C(=O)N(C)C)n2cc(-c3ncc(Cc4ccc(F)cc4)s3)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C27H29FN4O4S/c1-15(17-7-8-17)31-14-27(2,26(36)30(3)4)32-13-20(22(33)23(34)21(32)25(31)35)24-29-12-19(37-24)11-16-5-9-18(28)10-6-16/h5-6,9-10,12-13,15,17,34H,7-8,11,14H2,1-4H3/t15-,27+/m0/s1 |
| InChIKey | MUXKTLRIDKLMPQ-KUNJGFBQSA-N |
| XLogP | 3.46 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |