C24H25F2N5O4S — CID 69086853
(4R)-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-2-propan-2-yl-3H-pyrido[1,2-a]pyrazine-4-carboxamide (PubChem CID 69086853) has the molecular formula C24H25F2N5O4S and a molecular weight of 517.56 g/mol. Its IUPAC name is (4R)-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-2-propan-2-yl-3H-pyrido[1,2-a]pyrazine-4-carboxamide.
| Compound Name | (4R)-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-2-propan-2-yl-3H-pyrido[1,2-a]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 69086853 |
| Molecular Formula | C24H25F2N5O4S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (4R)-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-N,N,4-trimethyl-1,8-dioxo-2-propan-2-yl-3H-pyrido[1,2-a]pyrazine-4-carboxamide |
| SMILES | CC(C)N1C[C@](C)(C(=O)N(C)C)n2cc(-c3nnc(Cc4ccc(F)cc4F)s3)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C24H25F2N5O4S/c1-12(2)30-11-24(3,23(35)29(4)5)31-10-15(19(32)20(33)18(31)22(30)34)21-28-27-17(36-21)8-13-6-7-14(25)9-16(13)26/h6-7,9-10,12,33H,8,11H2,1-5H3/t24-/m1/s1 |
| InChIKey | JWJBWKONETVXRU-XMMPIXPASA-N |
| XLogP | 2.61 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |