C28H32F2N4O4S — CID 69087589
9-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-propan-2-ylspiro[3H-pyrido[1,2-a]pyrazine-4,4'-oxane]-1,8-dione (PubChem CID 69087589) has the molecular formula C28H32F2N4O4S and a molecular weight of 558.65 g/mol. Its IUPAC name is 9-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-propan-2-ylspiro[3H-pyrido[1,2-a]pyrazine-4,4'-oxane]-1,8-dione.
| Compound Name | 9-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-propan-2-ylspiro[3H-pyrido[1,2-a]pyrazine-4,4'-oxane]-1,8-dione |
|---|---|
| PubChem CID | 69087589 |
| Molecular Formula | C28H32F2N4O4S |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 9-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-propan-2-ylspiro[3H-pyrido[1,2-a]pyrazine-4,4'-oxane]-1,8-dione |
| SMILES | CCCCOc1c2n(cc(-c3nnc(Cc4ccc(F)cc4F)s3)c1=O)C1(CCOCC1)CN(C(C)C)C2=O |
| InChI | InChI=1S/C28H32F2N4O4S/c1-4-5-10-38-25-23-27(36)33(17(2)3)16-28(8-11-37-12-9-28)34(23)15-20(24(25)35)26-32-31-22(39-26)13-18-6-7-19(29)14-21(18)30/h6-7,14-15,17H,4-5,8-13,16H2,1-3H3 |
| InChIKey | QFGIRDVDPWMKME-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|