C31H37F2N5O5S — CID 118183533
tert-butyl 9-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-methyl-1,8-dioxospiro[4H-pyrido[1,2-a]pyrazine-3,4'-piperidine]-1'-carboxylate (PubChem CID 118183533) has the molecular formula C31H37F2N5O5S and a molecular weight of 629.73 g/mol. Its IUPAC name is tert-butyl 9-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-methyl-1,8-dioxospiro[4H-pyrido[1,2-a]pyrazine-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 9-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-methyl-1,8-dioxospiro[4H-pyrido[1,2-a]pyrazine-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 118183533 |
| Molecular Formula | C31H37F2N5O5S |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | tert-butyl 9-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-methyl-1,8-dioxospiro[4H-pyrido[1,2-a]pyrazine-3,4'-piperidine]-1'-carboxylate |
| SMILES | CCCCOc1c2n(cc(-c3nnc(Cc4ccc(F)cc4F)s3)c1=O)CC1(CCN(C(=O)OC(C)(C)C)CC1)N(C)C2=O |
| InChI | InChI=1S/C31H37F2N5O5S/c1-6-7-14-42-26-24-28(40)36(5)31(10-12-37(13-11-31)29(41)43-30(2,3)4)18-38(24)17-21(25(26)39)27-35-34-23(44-27)15-19-8-9-20(32)16-22(19)33/h8-9,16-17H,6-7,10-15,18H2,1-5H3 |
| InChIKey | NRYANQXOMVUIIS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 106.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|