C28H33F2N5O3S — CID 130253235
(2S,3S)-5'-butoxy-7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1',2,3,3'-tetramethylspiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-4',6'-dione (PubChem CID 130253235) has the molecular formula C28H33F2N5O3S and a molecular weight of 557.67 g/mol. Its IUPAC name is (2S,3S)-5'-butoxy-7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1',2,3,3'-tetramethylspiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-4',6'-dione.
| Compound Name | (2S,3S)-5'-butoxy-7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1',2,3,3'-tetramethylspiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-4',6'-dione |
|---|---|
| PubChem CID | 130253235 |
| Molecular Formula | C28H33F2N5O3S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | (2S,3S)-5'-butoxy-7'-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1',2,3,3'-tetramethylspiro[cyclopentane-1,2'-pyrido[2,1-f][1,2,4]triazine]-4',6'-dione |
| SMILES | CCCCOc1c2n(cc(-c3nnc(Cc4ccc(F)cc4F)s3)c1=O)N(C)C1(CC[C@H](C)[C@@H]1C)N(C)C2=O |
| InChI | InChI=1S/C28H33F2N5O3S/c1-6-7-12-38-25-23-27(37)33(4)28(11-10-16(2)17(28)3)34(5)35(23)15-20(24(25)36)26-32-31-22(39-26)13-18-8-9-19(29)14-21(18)30/h8-9,14-17H,6-7,10-13H2,1-5H3/t16-,17-,28?/m0/s1 |
| InChIKey | VCOSRIFKCYSJOT-VFEQBVOUSA-N |
| XLogP | 4.83 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|