C26H27F2N5O3S — CID 90245076
(1'S,5'R)-5-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1-methylspiro[3H-pyrido[2,1-f][1,2,4]triazine-2,2'-bicyclo[3.1.0]hexane]-4,6-dione (PubChem CID 90245076) has the molecular formula C26H27F2N5O3S and a molecular weight of 527.60 g/mol. Its IUPAC name is (1'S,5'R)-5-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1-methylspiro[3H-pyrido[2,1-f][1,2,4]triazine-2,2'-bicyclo[3.1.0]hexane]-4,6-dione.
| Compound Name | (1'S,5'R)-5-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1-methylspiro[3H-pyrido[2,1-f][1,2,4]triazine-2,2'-bicyclo[3.1.0]hexane]-4,6-dione |
|---|---|
| PubChem CID | 90245076 |
| Molecular Formula | C26H27F2N5O3S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | (1'S,5'R)-5-butoxy-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1-methylspiro[3H-pyrido[2,1-f][1,2,4]triazine-2,2'-bicyclo[3.1.0]hexane]-4,6-dione |
| SMILES | CCCCOc1c2n(cc(-c3nnc(Cc4ccc(F)cc4F)s3)c1=O)N(C)C1(CC[C@@H]3C[C@@H]31)NC2=O |
| InChI | InChI=1S/C26H27F2N5O3S/c1-3-4-9-36-23-21-24(35)29-26(8-7-14-10-18(14)26)32(2)33(21)13-17(22(23)34)25-31-30-20(37-25)11-15-5-6-16(27)12-19(15)28/h5-6,12-14,18H,3-4,7-11H2,1-2H3,(H,29,35)/t14-,18+,26?/m1/s1 |
| InChIKey | YHOPXZQGPHBBDB-GWTFAOQQSA-N |
| XLogP | 3.85 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|