C22H18F2N4O5S — CID 145021032
[13-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] acetate (PubChem CID 145021032) has the molecular formula C22H18F2N4O5S and a molecular weight of 488.47 g/mol. Its IUPAC name is [13-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] acetate.
| Compound Name | [13-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] acetate |
|---|---|
| PubChem CID | 145021032 |
| Molecular Formula | C22H18F2N4O5S |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | [13-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] acetate |
| SMILES | CC(=O)Oc1c2n(cc(-c3nnc(Cc4ccc(F)cc4F)s3)c1=O)CC1OCCCN1C2=O |
| InChI | InChI=1S/C22H18F2N4O5S/c1-11(29)33-20-18-22(31)28-5-2-6-32-17(28)10-27(18)9-14(19(20)30)21-26-25-16(34-21)7-12-3-4-13(23)8-15(12)24/h3-4,8-9,17H,2,5-7,10H2,1H3 |
| InChIKey | NRODOUZAVQPUJZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |