C6H13NO6 — CID 69089174
(4R,5S,6R,7S)-4-(hydroxymethyl)-1,3,2-dioxazocane-5,6,7-triol (PubChem CID 69089174) has the molecular formula C6H13NO6 and a molecular weight of 195.17 g/mol. Its IUPAC name is (4R,5S,6R,7S)-4-(hydroxymethyl)-1,3,2-dioxazocane-5,6,7-triol.
| Compound Name | (4R,5S,6R,7S)-4-(hydroxymethyl)-1,3,2-dioxazocane-5,6,7-triol |
|---|---|
| PubChem CID | 69089174 |
| Molecular Formula | C6H13NO6 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (4R,5S,6R,7S)-4-(hydroxymethyl)-1,3,2-dioxazocane-5,6,7-triol |
| SMILES | OC[C@H]1ONOC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO6/c8-1-4-6(11)5(10)3(9)2-12-7-13-4/h3-11H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | JFEXWDPJDCKLDB-SLPGGIOYSA-N |
| XLogP | -3.10 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |