C27H40BFN6O4 — CID 69090628
tert-butyl N-[(3S)-1-[3-[[3-amino-5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methylamino]-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 69090628) has the molecular formula C27H40BFN6O4 and a molecular weight of 542.47 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[3-[[3-amino-5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methylamino]-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[3-[[3-amino-5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methylamino]-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 69090628 |
| Molecular Formula | C27H40BFN6O4 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | tert-butyl N-[(3S)-1-[3-[[3-amino-5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methylamino]-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCN(c2ccncc2NCc2nc(B3OC(C)(C)C(C)(C)O3)c(F)cc2N)C1 |
| InChI | InChI=1S/C27H40BFN6O4/c1-25(2,3)37-24(36)33-17-9-8-12-35(16-17)22-10-11-31-14-21(22)32-15-20-19(30)13-18(29)23(34-20)28-38-26(4,5)27(6,7)39-28/h10-11,13-14,17,32H,8-9,12,15-16,30H2,1-7H3,(H,33,36)/t17-/m0/s1 |
| InChIKey | FKNOJYPTYJTBQU-KRWDZBQOSA-N |
| XLogP | 3.60 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|