C24H24N4 — CID 69092299
1-pyridin-2-yl-N,N-bis(1-pyridin-2-ylprop-2-enyl)prop-2-en-1-amine (PubChem CID 69092299) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-pyridin-2-yl-N,N-bis(1-pyridin-2-ylprop-2-enyl)prop-2-en-1-amine.
| Compound Name | 1-pyridin-2-yl-N,N-bis(1-pyridin-2-ylprop-2-enyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 69092299 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-pyridin-2-yl-N,N-bis(1-pyridin-2-ylprop-2-enyl)prop-2-en-1-amine |
| SMILES | C=CC(c1ccccn1)N(C(C=C)c1ccccn1)C(C=C)c1ccccn1 |
| InChI | InChI=1S/C24H24N4/c1-4-22(19-13-7-10-16-25-19)28(23(5-2)20-14-8-11-17-26-20)24(6-3)21-15-9-12-18-27-21/h4-18,22-24H,1-3H2 |
| InChIKey | QTKBYRSYTOUKBT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|