C10H10F3NO — CID 15261007
(1R,2R)-1-pyridin-2-yl-2-(trifluoromethyl)but-3-en-1-ol (PubChem CID 15261007) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is (1R,2R)-1-pyridin-2-yl-2-(trifluoromethyl)but-3-en-1-ol.
| Compound Name | (1R,2R)-1-pyridin-2-yl-2-(trifluoromethyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 15261007 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (1R,2R)-1-pyridin-2-yl-2-(trifluoromethyl)but-3-en-1-ol |
| SMILES | C=C[C@H]([C@@H](O)c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO/c1-2-7(10(11,12)13)9(15)8-5-3-4-6-14-8/h2-7,9,15H,1H2/t7-,9-/m1/s1 |
| InChIKey | FRVCNRHZGNANNA-VXNVDRBHSA-N |
| XLogP | 2.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|