C24H25N3O4S — CID 69101289
oxan-2-ylmethyl N-[4-[amino-(3-thiophen-2-ylphenyl)carbamoyl]phenyl]carbamate (PubChem CID 69101289) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is oxan-2-ylmethyl N-[4-[amino-(3-thiophen-2-ylphenyl)carbamoyl]phenyl]carbamate.
| Compound Name | oxan-2-ylmethyl N-[4-[amino-(3-thiophen-2-ylphenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69101289 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | oxan-2-ylmethyl N-[4-[amino-(3-thiophen-2-ylphenyl)carbamoyl]phenyl]carbamate |
| SMILES | NN(C(=O)c1ccc(NC(=O)OCC2CCCCO2)cc1)c1cccc(-c2cccs2)c1 |
| InChI | InChI=1S/C24H25N3O4S/c25-27(20-6-3-5-18(15-20)22-8-4-14-32-22)23(28)17-9-11-19(12-10-17)26-24(29)31-16-21-7-1-2-13-30-21/h3-6,8-12,14-15,21H,1-2,7,13,16,25H2,(H,26,29) |
| InChIKey | AIVWGXCVLMRFSQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|