C18H25ClN2O4 — CID 69109053
tert-butyl N-[1-(3-chlorophenyl)-2-(oxolane-3-carbonylamino)ethyl]carbamate (PubChem CID 69109053) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is tert-butyl N-[1-(3-chlorophenyl)-2-(oxolane-3-carbonylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(3-chlorophenyl)-2-(oxolane-3-carbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 69109053 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | tert-butyl N-[1-(3-chlorophenyl)-2-(oxolane-3-carbonylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CNC(=O)C1CCOC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-18(2,3)25-17(23)21-15(12-5-4-6-14(19)9-12)10-20-16(22)13-7-8-24-11-13/h4-6,9,13,15H,7-8,10-11H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | NDOUKQRLLCCQMU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |