C33H29ClN2O6S — CID 69110498
[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]phenyl] acetate (PubChem CID 69110498) has the molecular formula C33H29ClN2O6S and a molecular weight of 617.12 g/mol. Its IUPAC name is [4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]phenyl] acetate.
| Compound Name | [4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]phenyl] acetate |
|---|---|
| PubChem CID | 69110498 |
| Molecular Formula | C33H29ClN2O6S |
| Molecular Weight | 617.12 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | [4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CCNS(=O)(=O)c2ccc(Cl)cc2)c(OCc2cccc(OCc3ccc4ccccc4n3)c2)c1 |
| InChI | InChI=1S/C33H29ClN2O6S/c1-23(37)42-30-14-10-26(17-18-35-43(38,39)31-15-11-27(34)12-16-31)33(20-30)41-21-24-5-4-7-29(19-24)40-22-28-13-9-25-6-2-3-8-32(25)36-28/h2-16,19-20,35H,17-18,21-22H2,1H3 |
| InChIKey | RTZGUUCFGISEEV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.12 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|