C29H23FN2O5S — CID 54083461
3-fluoro-4-[2-[[7-(quinolin-2-ylmethoxy)naphthalen-2-yl]sulfonylamino]ethyl]benzoic acid (PubChem CID 54083461) has the molecular formula C29H23FN2O5S and a molecular weight of 530.58 g/mol. Its IUPAC name is 3-fluoro-4-[2-[[7-(quinolin-2-ylmethoxy)naphthalen-2-yl]sulfonylamino]ethyl]benzoic acid.
| Compound Name | 3-fluoro-4-[2-[[7-(quinolin-2-ylmethoxy)naphthalen-2-yl]sulfonylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 54083461 |
| Molecular Formula | C29H23FN2O5S |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 3-fluoro-4-[2-[[7-(quinolin-2-ylmethoxy)naphthalen-2-yl]sulfonylamino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCNS(=O)(=O)c2ccc3ccc(OCc4ccc5ccccc5n4)cc3c2)c(F)c1 |
| InChI | InChI=1S/C29H23FN2O5S/c30-27-17-22(29(33)34)6-5-20(27)13-14-31-38(35,36)26-12-9-19-8-11-25(15-23(19)16-26)37-18-24-10-7-21-3-1-2-4-28(21)32-24/h1-12,15-17,31H,13-14,18H2,(H,33,34) |
| InChIKey | MOTNVPXLEZZGBV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |