C26H17FN2O7S — CID 53329774
2-[[6-[(4-cyano-2-fluorophenyl)methoxy]naphthalen-2-yl]sulfonylamino]terephthalic acid (PubChem CID 53329774) has the molecular formula C26H17FN2O7S and a molecular weight of 520.49 g/mol. Its IUPAC name is 2-[[6-[(4-cyano-2-fluorophenyl)methoxy]naphthalen-2-yl]sulfonylamino]terephthalic acid.
| Compound Name | 2-[[6-[(4-cyano-2-fluorophenyl)methoxy]naphthalen-2-yl]sulfonylamino]terephthalic acid |
|---|---|
| PubChem CID | 53329774 |
| Molecular Formula | C26H17FN2O7S |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 2-[[6-[(4-cyano-2-fluorophenyl)methoxy]naphthalen-2-yl]sulfonylamino]terephthalic acid |
| SMILES | N#Cc1ccc(COc2ccc3cc(S(=O)(=O)Nc4cc(C(=O)O)ccc4C(=O)O)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C26H17FN2O7S/c27-23-9-15(13-28)1-2-19(23)14-36-20-6-3-17-11-21(7-4-16(17)10-20)37(34,35)29-24-12-18(25(30)31)5-8-22(24)26(32)33/h1-12,29H,14H2,(H,30,31)(H,32,33) |
| InChIKey | WNJCELVSXOBHDL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 153.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |